cas: 253315-11-6 — see every product listed under this CAS number, including other names
2-(4-(tert-Butoxycarbonyl)piperazin-1-yl)pyrimidine-5-carboxylic acid, 98%, 98% (CAS 253315-11-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FMMW-100mg |
| cas | 253315-11-6 |
| size | 100mg |
| availability | 175g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 779.60 Pln | |
| Chemat | 25g | 2426.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyrimidine-5-carboxylic acid (CAS 253315-11-6) is a chemical compound with the molecular formula C14H20N4O4 and a molecular weight of 308.33 g/mol. IUPAC name: 2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyrimidine-5-carboxylic acid. InChIKey: PCCFNCYKKKIXFX-UHFFFAOYSA-N.
| Molecular formula | C14H20N4O4 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | 2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyrimidine-5-carboxylic acid |
| InChIKey | PCCFNCYKKKIXFX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=NC=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)