cas: 253315-11-6 — see every product listed under this CAS number, including other names
2-(4-(tert-Butoxycarbonyl)piperazin-1-yl)pyrimidine-5-carboxylic acid, 98% (CAS 253315-11-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 2.5g, 5g, 10g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QD-9828-250mg |
| cas | 253315-11-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 414.46 Pln | |
| Fluorochem | 2.5g | 950.72 Pln | |
| Fluorochem | 5g | 1268.32 Pln | |
| Fluorochem | 10g | 2481.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyrimidine-5-carboxylic acid (CAS 253315-11-6) is a chemical compound with the molecular formula C14H20N4O4 and a molecular weight of 308.33 g/mol. IUPAC name: 2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyrimidine-5-carboxylic acid. InChIKey: PCCFNCYKKKIXFX-UHFFFAOYSA-N.
| Molecular formula | C14H20N4O4 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | 2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]pyrimidine-5-carboxylic acid |
| InChIKey | PCCFNCYKKKIXFX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=NC=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)