Products 2252258-81-2
CAS 2252258-81-2 appears in our catalog under these names: Palbociclib Impurity 73, Palbociclib Impurity 79. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-(5-nitro-3-pyridinyl)piperazine-1-carboxylate (CAS 2252258-81-2) is a chemical compound with the molecular formula C14H20N4O4 and a molecular weight of 308.33 g/mol. IUPAC name: tert-butyl 4-(5-nitro-3-pyridinyl)piperazine-1-carboxylate. InChIKey: CBWSZNNAYCKXTK-UHFFFAOYSA-N.
| Molecular formula | C14H20N4O4 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | tert-butyl 4-(5-nitro-3-pyridinyl)piperazine-1-carboxylate |
| InChIKey | CBWSZNNAYCKXTK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=CC(=CN=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)