cas: 36802-69-4 — see every product listed under this CAS number, including other names
2-(4-Amino-3-chlorophenyl)propanoic acid 97% (CAS 36802-69-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A348716-100mg |
| cas | 36802-69-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 370.38 Pln | |
| Ambeed | 1g | 871.00 Pln | |
| Ambeed | 5g | 2879.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A348716 |
2-(4-amino-3-chlorophenyl)propanoic acid (CAS 36802-69-4) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 2-(4-amino-3-chlorophenyl)propanoic acid. InChIKey: KLLHOJJBWVFBDF-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | 2-(4-amino-3-chlorophenyl)propanoic acid |
| InChIKey | KLLHOJJBWVFBDF-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)N)Cl)C(=O)O |
Computed by PubChem (NCBI)