2-(4-Amino-3-chlorophenyl)propanoic acid, 97%
cas: 36802-69-4 — see every product listed under this CAS number, including other names
2-(4-Amino-3-chlorophenyl)propanoic acid, 97% (CAS 36802-69-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A348716-100mg |
| cas | 36802-69-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 798.69 Pln | |
| Ambeed | 5g | 2623.19 Pln | |
| Ambeed | 10g | 4152.88 Pln | |
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 357.20 Pln | |
| Chemat | 1g | 846.80 Pln | |
| Chemat | 5g | 2814.80 Pln | |
| Chemat | 10g | 4461.20 Pln | |
| BLDpharm | 100mg | 242.16 Pln | |
| BLDpharm | 250mg | 358.79 Pln | |
| BLDpharm | 1g | 858.61 Pln | |
| BLDpharm | 5g | 2819.03 Pln | |
| BLDpharm | 10g | 4474.00 Pln | |
| Fluorochem | 100mg | 398.84 Pln | |
| Fluorochem | 250mg | 643.54 Pln | |
| Fluorochem | 1g | 1575.50 Pln | |
| Fluorochem | 5g | 5214.85 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-(4-amino-3-chlorophenyl)propanoic acid (CAS 36802-69-4) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 2-(4-amino-3-chlorophenyl)propanoic acid. InChIKey: KLLHOJJBWVFBDF-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | 2-(4-amino-3-chlorophenyl)propanoic acid |
| InChIKey | KLLHOJJBWVFBDF-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)N)Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(4-amino-3-chlorophenyl)propanoic acid, KLLHOJJBWVFBDF-UHFFFAOYSA-N, 2-(4-amino-3-chlorophenyl)propanoicacid, 2-(4-amino-3-chloro-phenyl)propanoic acid, 2-(4-amino-3-chlorophenyl) propionic acid, alpha-(4-amino-3-chlorophenyl)propionic acid, alpha-(4-amino-3-chlorophenyl)-propionic acid, Benzeneacetic acid, 4-amino-3-chloro-alpha-methyl-