cas: 13676-47-6 — see every product listed under this CAS number, including other names
2-(4-Aminophenyl)benzo[d]oxazol-5-amine 97% (CAS 13676-47-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A180699-1g |
| cas | 13676-47-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 10g | 170.12 Pln | |
| Ambeed | 25g | 192.38 Pln | |
| Ambeed | 100g | 548.38 Pln | |
| Ambeed | 500g | 2267.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A180699 |
2-(4-aminophenyl)-1,3-benzoxazol-5-amine (CAS 13676-47-6) is a chemical compound with the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. IUPAC name: 2-(4-aminophenyl)-1,3-benzoxazol-5-amine. InChIKey: UMGYJGHIMRFYSP-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 2-(4-aminophenyl)-1,3-benzoxazol-5-amine |
| InChIKey | UMGYJGHIMRFYSP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(O2)C=CC(=C3)N)N |
Computed by PubChem (NCBI)