Products 220635-18-7
CAS 220635-18-7 is the registry number for 5-(Naphthalen-2-ylmethyl)-1,3,4-oxadiazol-2-amine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-(naphthalen-2-ylmethyl)-1,3,4-oxadiazol-2-amine (CAS 220635-18-7) is a chemical compound with the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. IUPAC name: 5-(naphthalen-2-ylmethyl)-1,3,4-oxadiazol-2-amine. InChIKey: NXDLPMQTRAVDLA-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 5-(naphthalen-2-ylmethyl)-1,3,4-oxadiazol-2-amine |
| InChIKey | NXDLPMQTRAVDLA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)CC3=NN=C(O3)N |
Computed by PubChem (NCBI)