cas: 13676-47-6 — see every product listed under this CAS number, including other names
2-(4-Aminophenyl)-5-benzoxazolamine, 97%, 97% (CAS 13676-47-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1123BM-5g |
| cas | 13676-47-6 |
| size | 5g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 136.40 Pln | |
| Chemat | 100g | 352.40 Pln | |
| Chemat | 10g | 93.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(4-aminophenyl)-1,3-benzoxazol-5-amine (CAS 13676-47-6) is a chemical compound with the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. IUPAC name: 2-(4-aminophenyl)-1,3-benzoxazol-5-amine. InChIKey: UMGYJGHIMRFYSP-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 2-(4-aminophenyl)-1,3-benzoxazol-5-amine |
| InChIKey | UMGYJGHIMRFYSP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(O2)C=CC(=C3)N)N |
Computed by PubChem (NCBI)