cas: 2221812-18-4 — see every product listed under this CAS number, including other names
2-(4-Bromo-2,5-dimethylphenyl)-1,3-dioxolane, ≥95%, ≥95% (CAS 2221812-18-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch132QFJ-1g |
| cas | 2221812-18-4 |
| size | 1g |
| availability | 92g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2483.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-(4-bromo-2,5-dimethylphenyl)-1,3-dioxolane (CAS 2221812-18-4) is a chemical compound with the molecular formula C11H13BrO2 and a molecular weight of 257.12 g/mol. IUPAC name: 2-(4-bromo-2,5-dimethylphenyl)-1,3-dioxolane. InChIKey: XXIDFGBJRJSRJI-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO2 |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 2-(4-bromo-2,5-dimethylphenyl)-1,3-dioxolane |
| InChIKey | XXIDFGBJRJSRJI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)C)C2OCCO2 |
Computed by PubChem (NCBI)