CAS 3360-64-3 appears in our catalog under these names: 4-Bromo-2,3,5,6-tetramethylbenzoic acid, 96%, 4-Bromo-2,3,5,6-tetramethylbenzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
4-bromo-2,3,5,6-tetramethylbenzoic acid (CAS 3360-64-3) is a chemical compound with the molecular formula C11H13BrO2 and a molecular weight of 257.12 g/mol. IUPAC name: 4-bromo-2,3,5,6-tetramethylbenzoic acid. InChIKey: SPUCMYKNWOMAQX-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO2 |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 4-bromo-2,3,5,6-tetramethylbenzoic acid |
| InChIKey | SPUCMYKNWOMAQX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C(=O)O)C)C)Br)C |
Computed by PubChem (NCBI)