CAS 794465-45-5 appears in our catalog under these names: 3-bromo-5-tert-butylbenzoic acid, 95%, 3-Bromo-5-tert-butylbenzoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 250mg, 1g, 50mg.
3-bromo-5-tert-butylbenzoic acid (CAS 794465-45-5) is a chemical compound with the molecular formula C11H13BrO2 and a molecular weight of 257.12 g/mol. IUPAC name: 3-bromo-5-tert-butylbenzoic acid. InChIKey: JWIWYJFPAQCUGT-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO2 |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 3-bromo-5-tert-butylbenzoic acid |
| InChIKey | JWIWYJFPAQCUGT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)C(=O)O)Br |
Computed by PubChem (NCBI)