cas: 1165935-85-2 — see every product listed under this CAS number, including other names
2-(4-Chloro-2-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% (CAS 1165935-85-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A740461-1g |
| cas | 1165935-85-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 447.58 Pln | |
| AmBeed | 250mg | 382.48 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[4-chloro-2-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1165935-85-2) is a chemical compound with the molecular formula C13H15BClF3O2 and a molecular weight of 306.52 g/mol. IUPAC name: 2-[4-chloro-2-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LXNGZRBNPCAJOD-UHFFFAOYSA-N.
| Molecular formula | C13H15BClF3O2 |
|---|---|
| Molecular weight | 306.52 g/mol |
| IUPAC name | 2-[4-chloro-2-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LXNGZRBNPCAJOD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)