Products 2246545-93-5
CAS 2246545-93-5 is the registry number for 2-(3-Chloro-2-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-[3-chloro-2-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2246545-93-5) is a chemical compound with the molecular formula C13H15BClF3O2 and a molecular weight of 306.52 g/mol. IUPAC name: 2-[3-chloro-2-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: MWYCWYYETHUQGL-UHFFFAOYSA-N.
| Molecular formula | C13H15BClF3O2 |
|---|---|
| Molecular weight | 306.52 g/mol |
| IUPAC name | 2-[3-chloro-2-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | MWYCWYYETHUQGL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)