CAS 445303-09-3 appears in our catalog under these names: 4-Chloro-3-trifluoromethylphenylboronic acid, pinacol ester, 97%, 4-Chloro-3-trifluoromethylphenylboronic acid, pinacol ester, 98%, 98%, 4-Chloro-3-(trifluoromethyl)phenylboronic acid pinacol ester, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 25g, 100g.
2-[4-chloro-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 445303-09-3) is a chemical compound with the molecular formula C13H15BClF3O2 and a molecular weight of 306.52 g/mol. IUPAC name: 2-[4-chloro-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VBNMWVUQPRYIIM-UHFFFAOYSA-N.
| Molecular formula | C13H15BClF3O2 |
|---|---|
| Molecular weight | 306.52 g/mol |
| IUPAC name | 2-[4-chloro-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VBNMWVUQPRYIIM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)