cas: 5468-66-6 — see every product listed under this CAS number, including other names
2-(4-Chlorobenzyl)benzimidazole 98% (CAS 5468-66-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A114042-10g |
| cas | 5468-66-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 164.56 Pln | |
| Ambeed | 100g | 303.62 Pln | |
| Ambeed | 500g | 1010.06 Pln | |
| Ambeed | 1000g | 1694.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A114042 |
2-[(4-chlorophenyl)methyl]-1H-benzimidazole (CAS 5468-66-6) is a chemical compound with the molecular formula C14H11ClN2 and a molecular weight of 242.70 g/mol. IUPAC name: 2-[(4-chlorophenyl)methyl]-1H-benzimidazole. InChIKey: COGUOPIIFAMLES-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 2-[(4-chlorophenyl)methyl]-1H-benzimidazole |
| InChIKey | COGUOPIIFAMLES-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)CC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)