cas: 5468-66-6 — see every product listed under this CAS number, including other names
2-(4-Chlorobenzyl)benzimidazole, 99%, 99% (CAS 5468-66-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0RR-5g |
| cas | 5468-66-6 |
| size | 5g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 100g | 155.60 Pln | |
| Chemat | 500g | 595.20 Pln | |
| Chemat | 1kg | 1110.80 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
2-[(4-chlorophenyl)methyl]-1H-benzimidazole (CAS 5468-66-6) is a chemical compound with the molecular formula C14H11ClN2 and a molecular weight of 242.70 g/mol. IUPAC name: 2-[(4-chlorophenyl)methyl]-1H-benzimidazole. InChIKey: COGUOPIIFAMLES-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 2-[(4-chlorophenyl)methyl]-1H-benzimidazole |
| InChIKey | COGUOPIIFAMLES-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)CC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)