2-(4-Chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95%
cas: 195062-61-4 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95% (CAS 195062-61-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I449-1g |
| cas | 195062-61-4 |
| size | 1g |
| availability | 200g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 25g | 131.60 Pln | |
| Chemat | 100g | 328.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(4-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 195062-61-4) is a chemical compound with the molecular formula C12H16BClO2 and a molecular weight of 238.52 g/mol. IUPAC name: 2-(4-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: NYARTXMDWRAVIX-UHFFFAOYSA-N.
| Molecular formula | C12H16BClO2 |
|---|---|
| Molecular weight | 238.52 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | NYARTXMDWRAVIX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(4-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 4-Chlorophenylboronic acid pinacol ester, 4-chlorophenyl boronic acid pinacol ester, 4-Chlorophenylboronic acid pinacol ester, 97%, 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)chlorobenzene, 4-Chlorobenzeneboronic acid, pinacol ester, 1-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene