cas: 195062-61-4 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 195062-61-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219129-5G |
| cas | 195062-61-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 133.30 Pln | |
| Fluorochem | 25g | 206.20 Pln | |
| Fluorochem | 100g | 508.17 Pln | |
| Fluorochem | 500g | 2247.14 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 195062-61-4) is a chemical compound with the molecular formula C12H16BClO2 and a molecular weight of 238.52 g/mol. IUPAC name: 2-(4-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: NYARTXMDWRAVIX-UHFFFAOYSA-N.
| Molecular formula | C12H16BClO2 |
|---|---|
| Molecular weight | 238.52 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | NYARTXMDWRAVIX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)