cas: 195062-61-4 — see every product listed under this CAS number, including other names
4-Chlorophenylboronic acid pinacol ester, 97% (CAS 195062-61-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 444690050 |
| cas | 195062-61-4 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 296.22 Pln | |
| Thermo Scientific (Acros) | 25g | 979.98 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
2-(4-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 195062-61-4) is a chemical compound with the molecular formula C12H16BClO2 and a molecular weight of 238.52 g/mol. IUPAC name: 2-(4-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: NYARTXMDWRAVIX-UHFFFAOYSA-N.
| Molecular formula | C12H16BClO2 |
|---|---|
| Molecular weight | 238.52 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | NYARTXMDWRAVIX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)