2-(4-Chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%
cas: 195062-61-4 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% (CAS 195062-61-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A135150-1g |
| cas | 195062-61-4 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 231.31 Pln | |
| Ambeed | 100g | 553.94 Pln | |
| Ambeed | 500g | 2278.31 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 203.29 Pln | |
| BLDpharm | 10g | 219.95 Pln | |
| BLDpharm | 25g | 242.16 Pln | |
| BLDpharm | 100g | 586.48 Pln | |
| BLDpharm | 500g | 2446.94 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-(4-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 195062-61-4) is a chemical compound with the molecular formula C12H16BClO2 and a molecular weight of 238.52 g/mol. IUPAC name: 2-(4-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: NYARTXMDWRAVIX-UHFFFAOYSA-N.
| Molecular formula | C12H16BClO2 |
|---|---|
| Molecular weight | 238.52 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | NYARTXMDWRAVIX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)
Synonyms:
2-(4-chlorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 4-Chlorophenylboronic acid pinacol ester, 4-chlorophenyl boronic acid pinacol ester, 4-Chlorophenylboronic acid pinacol ester, 97%, 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)chlorobenzene, 4-Chlorobenzeneboronic acid, pinacol ester, 1-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzene