cas: 103844-28-6 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)-6-methylimidazo(1,2-a)pyridine, 98% (CAS 103844-28-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1714426-5g |
| cas | 103844-28-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 3624.46 Pln | |
| AmBeed | 10g | 6163.36 Pln | |
| AmBeed | 25g | 12002.83 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(4-chlorophenyl)-6-methylimidazo[1,2-a]pyridine (CAS 103844-28-6) is a chemical compound with the molecular formula C14H11ClN2 and a molecular weight of 242.70 g/mol. IUPAC name: 2-(4-chlorophenyl)-6-methylimidazo[1,2-a]pyridine. InChIKey: IHXCPOUKJROXJU-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-6-methylimidazo[1,2-a]pyridine |
| InChIKey | IHXCPOUKJROXJU-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(N=C2C=C1)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)