cas: 103844-28-6 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)-6-methylimidazo[1,2-a]pyridine, 98% (CAS 103844-28-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F630044-250MG |
| cas | 103844-28-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 435.28 Pln | |
| Fluorochem | 1g | 820.56 Pln | |
| Fluorochem | 5g | 1924.34 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-chlorophenyl)-6-methylimidazo[1,2-a]pyridine (CAS 103844-28-6) is a chemical compound with the molecular formula C14H11ClN2 and a molecular weight of 242.70 g/mol. IUPAC name: 2-(4-chlorophenyl)-6-methylimidazo[1,2-a]pyridine. InChIKey: IHXCPOUKJROXJU-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2 |
|---|---|
| Molecular weight | 242.70 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-6-methylimidazo[1,2-a]pyridine |
| InChIKey | IHXCPOUKJROXJU-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(N=C2C=C1)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)