2-(4-Chlorophenyl)pyridine, 98%
cas: 5969-83-5 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)pyridine, 98% (CAS 5969-83-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A167443-100mg |
| cas | 5969-83-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 431.56 Pln | |
| Ambeed | 5g | 1399.44 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 712.40 Pln | |
| Chemat | 25g | 2987.60 Pln | |
| Fluorochem | 5g | 1382.86 Pln | |
| Fluorochem | 25g | 5100.31 Pln | |
| Fluorochem | 1g | 398.84 Pln | |
| BLDpharm | 100mg | 153.30 Pln | |
| BLDpharm | 250mg | 181.07 Pln | |
| BLDpharm | 1g | 458.75 Pln | |
| BLDpharm | 5g | 1502.83 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-(4-chlorophenyl)pyridine (CAS 5969-83-5) is a chemical compound with the molecular formula C11H8ClN and a molecular weight of 189.64 g/mol. IUPAC name: 2-(4-chlorophenyl)pyridine. InChIKey: WHXIEVDMCNQVOV-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN |
|---|---|
| Molecular weight | 189.64 g/mol |
| IUPAC name | 2-(4-chlorophenyl)pyridine |
| InChIKey | WHXIEVDMCNQVOV-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)