CAS 292068-12-3 appears in our catalog under these names: 3-Chloro-5-phenylpyridine, ≥95%, 3-Chloro-5-phenylpyridine, ≥95%, ≥95%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g.
3-chloro-5-phenylpyridine (CAS 292068-12-3) is a chemical compound with the molecular formula C11H8ClN and a molecular weight of 189.64 g/mol. IUPAC name: 3-chloro-5-phenylpyridine. InChIKey: FQQRGAUVWHBXDN-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN |
|---|---|
| Molecular weight | 189.64 g/mol |
| IUPAC name | 3-chloro-5-phenylpyridine |
| InChIKey | FQQRGAUVWHBXDN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CN=C2)Cl |
Computed by PubChem (NCBI)