CAS 42260-39-9 appears in our catalog under these names: 2–chloro–4–phenylpyridine, 2-Chloro-4-phenylpyridine 97%, 2-Chloro-4-Phenylpyridine, 97%, 97%, 2-Chloro-4-phenylpyridine, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g, 500mg.
2-chloro-4-phenylpyridine (CAS 42260-39-9) is a chemical compound with the molecular formula C11H8ClN and a molecular weight of 189.64 g/mol. IUPAC name: 2-chloro-4-phenylpyridine. InChIKey: MROTUXXYBNRZSG-UHFFFAOYSA-N.
| Molecular formula | C11H8ClN |
|---|---|
| Molecular weight | 189.64 g/mol |
| IUPAC name | 2-chloro-4-phenylpyridine |
| InChIKey | MROTUXXYBNRZSG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC=C2)Cl |
Computed by PubChem (NCBI)