cas: 1040281-84-2 — see every product listed under this CAS number, including other names
2-(4-Chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95% (CAS 1040281-84-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A396175-100mg |
| cas | 1040281-84-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 826.50 Pln | |
| Ambeed | 250mg | 1594.12 Pln | |
| Ambeed | 1g | 4675.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A396175 |
2-(4-chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1040281-84-2) is a chemical compound with the molecular formula C10H14BClO2S and a molecular weight of 244.55 g/mol. IUPAC name: 2-(4-chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FQPQQVUHQXLKDP-UHFFFAOYSA-N.
| Molecular formula | C10H14BClO2S |
|---|---|
| Molecular weight | 244.55 g/mol |
| IUPAC name | 2-(4-chlorothiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FQPQQVUHQXLKDP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CS2)Cl |
Computed by PubChem (NCBI)