CAS 79925-16-9 appears in our catalog under these names: 2-(4-Cyanophenoxy)-2-methylpropanoic acid, 95%, 2-(4-CYANOPHENOXY)-2-METHYLPROPANOIC ACID, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 250mg, 1g, 10g.
2-(4-cyanophenoxy)-2-methylpropanoic acid (CAS 79925-16-9) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 2-(4-cyanophenoxy)-2-methylpropanoic acid. InChIKey: GBGYSMXMZDBILF-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 2-(4-cyanophenoxy)-2-methylpropanoic acid |
| InChIKey | GBGYSMXMZDBILF-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)OC1=CC=C(C=C1)C#N |
Computed by PubChem (NCBI)