cas: 1261268-85-2 — see every product listed under this CAS number, including other names
2-(4-Diphenylmethyl-1-piperazinyl)ethyl Acetoacetate Oxalate, ≥95%, ≥95% (CAS 1261268-85-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111RP7-100mg |
| cas | 1261268-85-2 |
| size | 100mg |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 558.80 Pln | |
| Chemat | 10g | 808.40 Pln | |
| Chemat | 25g | 1542.80 Pln | |
| Chemat | 100g | 3165.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-(4-benzhydrylpiperazin-1-yl)ethyl 3-oxobutanoate;oxalic acid (CAS 1261268-85-2) is a chemical compound with the molecular formula C25H30N2O7 and a molecular weight of 470.5 g/mol. IUPAC name: 2-(4-benzhydrylpiperazin-1-yl)ethyl 3-oxobutanoate;oxalic acid. InChIKey: VGYLHXBAEHXIPS-UHFFFAOYSA-N.
| Molecular formula | C25H30N2O7 |
|---|---|
| Molecular weight | 470.5 g/mol |
| IUPAC name | 2-(4-benzhydrylpiperazin-1-yl)ethyl 3-oxobutanoate;oxalic acid |
| InChIKey | VGYLHXBAEHXIPS-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)OCCN1CCN(CC1)C(C2=CC=CC=C2)C3=CC=CC=C3.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)