CAS 613245-91-3 appears in our catalog under these names: N-(Fmoc-8-amino-3,6-dioxa-octyl)-succinamic acid, 98%, Fmoc–amino–PEG2–ethylamino–Suc–OH, Fmoc-Ebes, Fmoc-PEG2-Suc-OH 95%, N-(FMOC-8-AMINO-3,6-DIOXA-OCTYL)SUCCINAMIC ACID, 95%, 95%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg, 25g, 100g, 100mg.
4-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethylamino]-4-oxobutanoic acid (CAS 613245-91-3) is a chemical compound with the molecular formula C25H30N2O7 and a molecular weight of 470.5 g/mol. IUPAC name: 4-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethylamino]-4-oxobutanoic acid. InChIKey: OVPIGBISTJOKKI-UHFFFAOYSA-N.
| Molecular formula | C25H30N2O7 |
|---|---|
| Molecular weight | 470.5 g/mol |
| IUPAC name | 4-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethylamino]-4-oxobutanoic acid |
| InChIKey | OVPIGBISTJOKKI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCCOCCNC(=O)CCC(=O)O |
Computed by PubChem (NCBI)