Products 1261268-85-2
CAS 1261268-85-2 appears in our catalog under these names: 2–(4–Diphenylmethyl–1–piperazinyl)ethyl Acetoacetate Oxalate, 2-(4-Diphenylmethyl-1-piperazinyl)ethyl acetoacetate oxalate, 95%, Manidipine Impurity 1 Oxalate, 2-(4-Diphenylmethyl-1-piperazinyl)ethyl Acetoacetate Oxalate, ≥95%, ≥95%. Offered by: GLPBio, Combi-blocks, Chemat Brand, Chemat. Available pack sizes: 1g, 5g, 10g, on request, 100mg, 250mg, 25g, 100g.
2-(4-benzhydrylpiperazin-1-yl)ethyl 3-oxobutanoate;oxalic acid (CAS 1261268-85-2) is a chemical compound with the molecular formula C25H30N2O7 and a molecular weight of 470.5 g/mol. IUPAC name: 2-(4-benzhydrylpiperazin-1-yl)ethyl 3-oxobutanoate;oxalic acid. InChIKey: VGYLHXBAEHXIPS-UHFFFAOYSA-N.
| Molecular formula | C25H30N2O7 |
|---|---|
| Molecular weight | 470.5 g/mol |
| IUPAC name | 2-(4-benzhydrylpiperazin-1-yl)ethyl 3-oxobutanoate;oxalic acid |
| InChIKey | VGYLHXBAEHXIPS-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)OCCN1CCN(CC1)C(C2=CC=CC=C2)C3=CC=CC=C3.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)