cas: 885278-69-3 — see every product listed under this CAS number, including other names
2-(4-Ethyl-phenyl)-thiazole-4-carboxylic acid ethyl ester, 95%, 95% (CAS 885278-69-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1190AH-100mg |
| cas | 885278-69-3 |
| size | 100mg |
| availability | 0.6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 818.00 Pln | |
| Chemat | 250mg | 1370.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate (CAS 885278-69-3) is a chemical compound with the molecular formula C14H15NO2S and a molecular weight of 261.34 g/mol. IUPAC name: ethyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate. InChIKey: VZKQGDPMMDOKOS-UHFFFAOYSA-N.
| Molecular formula | C14H15NO2S |
|---|---|
| Molecular weight | 261.34 g/mol |
| IUPAC name | ethyl 2-(4-ethylphenyl)-1,3-thiazole-4-carboxylate |
| InChIKey | VZKQGDPMMDOKOS-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=NC(=CS2)C(=O)OCC |
Computed by PubChem (NCBI)