CAS 1082911-15-6 is the registry number for 4-[(3-Methylphenyl)methanesulfonyl]aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-[(3-methylphenyl)methylsulfonyl]aniline (CAS 1082911-15-6) is a chemical compound with the molecular formula C14H15NO2S and a molecular weight of 261.34 g/mol. IUPAC name: 4-[(3-methylphenyl)methylsulfonyl]aniline. InChIKey: PCAOUNCUYPGHSD-UHFFFAOYSA-N.
| Molecular formula | C14H15NO2S |
|---|---|
| Molecular weight | 261.34 g/mol |
| IUPAC name | 4-[(3-methylphenyl)methylsulfonyl]aniline |
| InChIKey | PCAOUNCUYPGHSD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)CS(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)