Products 885278-63-7

CAS 885278-63-7 is the registry number for 2-(3,5-Dimethyl-phenyl)-thiazole-4-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-(3,5-dimethylphenyl)-1,3-thiazole-4-carboxylate (CAS 885278-63-7) is a chemical compound with the molecular formula C14H15NO2S and a molecular weight of 261.34 g/mol. IUPAC name: ethyl 2-(3,5-dimethylphenyl)-1,3-thiazole-4-carboxylate. InChIKey: QXJHMEJCXWUZSD-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15NO2S
Molecular weight261.34 g/mol
IUPAC nameethyl 2-(3,5-dimethylphenyl)-1,3-thiazole-4-carboxylate
InChIKeyQXJHMEJCXWUZSD-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CSC(=N1)C2=CC(=CC(=C2)C)C

Computed by PubChem (NCBI)