cas: 1034287-04-1 — see every product listed under this CAS number, including other names
2-(4-Ethynyl-phenyl)-4,4,5,5-tetramethyl-[1,3,2]-dioxaborolane, 97% (CAS 1034287-04-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F546472-250MG |
| cas | 1034287-04-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 435.28 Pln | |
| Fluorochem | 5g | 1601.54 Pln | |
| Fluorochem | 25g | 6589.36 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-(4-ethynylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1034287-04-1) is a chemical compound with the molecular formula C14H17BO2 and a molecular weight of 228.10 g/mol. IUPAC name: 2-(4-ethynylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LOVNTFMVZVIASV-UHFFFAOYSA-N.
| Molecular formula | C14H17BO2 |
|---|---|
| Molecular weight | 228.10 g/mol |
| IUPAC name | 2-(4-ethynylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LOVNTFMVZVIASV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C#C |
Computed by PubChem (NCBI)