CAS 1034287-04-1 appears in our catalog under these names: 4-Ethynylbenzeneboronic acid pinacol ester, 96%, 4–Ethynylphenylboronic acid pinacol ester, 4-Ethynylbenzeneboronic acid pinacol ester, 95% , 2-(4-Ethynyl-phenyl)-4,4,5,5-tetramethyl-[1,3,2]-dioxaborolane 95%, 4-ETHYNYLPHENYLBORONIC ACID PINACOL EST&. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Sigma-Aldrich. Available pack sizes: 5g, 1g, 250mg, 100mg, 25g.
2-(4-ethynylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1034287-04-1) is a chemical compound with the molecular formula C14H17BO2 and a molecular weight of 228.10 g/mol. IUPAC name: 2-(4-ethynylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: LOVNTFMVZVIASV-UHFFFAOYSA-N.
| Molecular formula | C14H17BO2 |
|---|---|
| Molecular weight | 228.10 g/mol |
| IUPAC name | 2-(4-ethynylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | LOVNTFMVZVIASV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C#C |
Computed by PubChem (NCBI)