CAS 946168-04-3 appears in our catalog under these names: 3-Ethynylbenzeneboronic acid pinacol ester, 95% , 2-(3-Ethynylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 2-(3-Ethynylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95%. Offered by: Thermo Scientific (Alfa Aesar), Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 50mg, 100mg, 250mg.
2-(3-ethynylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 946168-04-3) is a chemical compound with the molecular formula C14H17BO2 and a molecular weight of 228.10 g/mol. IUPAC name: 2-(3-ethynylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: SJDFLZSEQGKSDJ-UHFFFAOYSA-N.
| Molecular formula | C14H17BO2 |
|---|---|
| Molecular weight | 228.10 g/mol |
| IUPAC name | 2-(3-ethynylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | SJDFLZSEQGKSDJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C#C |
Computed by PubChem (NCBI)