cas: 1629-26-1 — see every product listed under this CAS number, including other names
2-(4-FLuorophenyl)benzothiazole, 95%, 95% (CAS 1629-26-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112TJC-100mg |
| cas | 1629-26-1 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 544.40 Pln | |
| Chemat | 250mg | 856.40 Pln | |
| Chemat | 1g | 1379.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(4-fluorophenyl)-1,3-benzothiazole (CAS 1629-26-1) is a chemical compound with the molecular formula C13H8FNS and a molecular weight of 229.27 g/mol. IUPAC name: 2-(4-fluorophenyl)-1,3-benzothiazole. InChIKey: MWIDLEVLPMTJDU-UHFFFAOYSA-N.
| Molecular formula | C13H8FNS |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-1,3-benzothiazole |
| InChIKey | MWIDLEVLPMTJDU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)