CAS 1629-94-3 is the registry number for 6-Fluoro-2-phenyl-1,3-benzothiazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
6-fluoro-2-phenyl-1,3-benzothiazole (CAS 1629-94-3) is a chemical compound with the molecular formula C13H8FNS and a molecular weight of 229.27 g/mol. IUPAC name: 6-fluoro-2-phenyl-1,3-benzothiazole. InChIKey: MBDZJNBYKCQZLG-UHFFFAOYSA-N.
| Molecular formula | C13H8FNS |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 6-fluoro-2-phenyl-1,3-benzothiazole |
| InChIKey | MBDZJNBYKCQZLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(S2)C=C(C=C3)F |
Computed by PubChem (NCBI)