CAS 348168-76-3 is the registry number for 2-Fluoro-6-(phenylsulfanyl)benzonitrile, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-fluoro-6-phenylsulfanylbenzonitrile (CAS 348168-76-3) is a chemical compound with the molecular formula C13H8FNS and a molecular weight of 229.27 g/mol. IUPAC name: 2-fluoro-6-phenylsulfanylbenzonitrile. InChIKey: RKCCNSBWSXDGIE-UHFFFAOYSA-N.
| Molecular formula | C13H8FNS |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 2-fluoro-6-phenylsulfanylbenzonitrile |
| InChIKey | RKCCNSBWSXDGIE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=CC=CC(=C2C#N)F |
Computed by PubChem (NCBI)