cas: 883742-29-8 — see every product listed under this CAS number, including other names
2-(4-Hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 883742-29-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F363997-250MG |
| cas | 883742-29-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 341.56 Pln | |
| Fluorochem | 1g | 508.17 Pln | |
| Fluorochem | 5g | 1611.95 Pln | |
| Fluorochem | 25g | 5870.87 Pln |
| delivery time | 3-4 weeks |
|---|
2-(4-hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 883742-29-8) is a chemical compound with the molecular formula C16H27BO2S and a molecular weight of 294.3 g/mol. IUPAC name: 2-(4-hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QEFQFMZHWUCJOA-UHFFFAOYSA-N.
| Molecular formula | C16H27BO2S |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | 2-(4-hexylthiophen-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QEFQFMZHWUCJOA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CS2)CCCCCC |
Computed by PubChem (NCBI)