cas: 213596-33-9 — see every product listed under this CAS number, including other names
2-(4-Methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane, ≥97-<99% (CAS 213596-33-9) is a chemical reagent available from Chemat. Available pack sizes: 100g, 200g, 300g, 400g, 500g, 600g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC79-97-99-100g |
| cas | 213596-33-9 |
| size | 100g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 100g | 4206.18 Pln | |
| Hoffman Fine Chemicals | 200g | 6534.88 Pln | |
| Hoffman Fine Chemicals | 300g | 7791.74 Pln | |
| Hoffman Fine Chemicals | 400g | 8787.02 Pln | |
| Hoffman Fine Chemicals | 500g | 9846.10 Pln | |
| Hoffman Fine Chemicals | 600g | 10037.50 Pln |
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
2-(4-methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane (CAS 213596-33-9) is a chemical compound with the molecular formula C12H17BO3 and a molecular weight of 220.07 g/mol. IUPAC name: 2-(4-methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane. InChIKey: JTJMYIZHNJBNRY-UHFFFAOYSA-N.
| Molecular formula | C12H17BO3 |
|---|---|
| Molecular weight | 220.07 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| InChIKey | JTJMYIZHNJBNRY-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)