cas: 213596-33-9 — see every product listed under this CAS number, including other names
2-(4-Methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane, 97%, 97% (CAS 213596-33-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1183O4-1g |
| cas | 213596-33-9 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 194.00 Pln | |
| Chemat | 25g | 525.20 Pln | |
| Chemat | 100g | 1514.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(4-methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane (CAS 213596-33-9) is a chemical compound with the molecular formula C12H17BO3 and a molecular weight of 220.07 g/mol. IUPAC name: 2-(4-methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane. InChIKey: JTJMYIZHNJBNRY-UHFFFAOYSA-N.
| Molecular formula | C12H17BO3 |
|---|---|
| Molecular weight | 220.07 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| InChIKey | JTJMYIZHNJBNRY-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)