cas: 938146-50-0 — see every product listed under this CAS number, including other names
2-(4-Methylpiperazin-1-yl)propanoic acid, 98%, 98% (CAS 938146-50-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11J45W-100mg |
| cas | 938146-50-0 |
| size | 100mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 429.20 Pln | |
| Chemat | 250mg | 683.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(4-methylpiperazin-1-yl)propanoic acid;dihydrochloride (CAS 938146-50-0) is a chemical compound with the molecular formula C8H18Cl2N2O2 and a molecular weight of 245.14 g/mol. IUPAC name: 2-(4-methylpiperazin-1-yl)propanoic acid;dihydrochloride. InChIKey: PKNRKZSHJWXBRW-UHFFFAOYSA-N.
| Molecular formula | C8H18Cl2N2O2 |
|---|---|
| Molecular weight | 245.14 g/mol |
| IUPAC name | 2-(4-methylpiperazin-1-yl)propanoic acid;dihydrochloride |
| InChIKey | PKNRKZSHJWXBRW-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)N1CCN(CC1)C.Cl.Cl |
Computed by PubChem (NCBI)