CAS 1609402-69-8 is the registry number for [Trans-4-(4-morpholinyl)tetrahydro-3-furanyl]amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
(3R,4R)-4-morpholin-4-yloxolan-3-amine;dihydrochloride (CAS 1609402-69-8) is a chemical compound with the molecular formula C8H18Cl2N2O2 and a molecular weight of 245.14 g/mol. IUPAC name: (3R,4R)-4-morpholin-4-yloxolan-3-amine;dihydrochloride. InChIKey: FIAGLSZSPSHYBD-FOMWZSOGSA-N.
| Molecular formula | C8H18Cl2N2O2 |
|---|---|
| Molecular weight | 245.14 g/mol |
| IUPAC name | (3R,4R)-4-morpholin-4-yloxolan-3-amine;dihydrochloride |
| InChIKey | FIAGLSZSPSHYBD-FOMWZSOGSA-N |
| SMILES | C1COCCN1[C@H]2COC[C@@H]2N.Cl.Cl |
Computed by PubChem (NCBI)