Products 1308384-28-2

CAS 1308384-28-2 is the registry number for Methyl 1-methyl-1,4-diazepane-2-carboxylate dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 1-methyl-1,4-diazepane-2-carboxylate;dihydrochloride (CAS 1308384-28-2) is a chemical compound with the molecular formula C8H18Cl2N2O2 and a molecular weight of 245.14 g/mol. IUPAC name: methyl 1-methyl-1,4-diazepane-2-carboxylate;dihydrochloride. InChIKey: RQDCBTOADDDFQO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H18Cl2N2O2
Molecular weight245.14 g/mol
IUPAC namemethyl 1-methyl-1,4-diazepane-2-carboxylate;dihydrochloride
InChIKeyRQDCBTOADDDFQO-UHFFFAOYSA-N
SMILESCN1CCCNCC1C(=O)OC.Cl.Cl

Computed by PubChem (NCBI)