cas: 42027-81-6 — see every product listed under this CAS number, including other names
2-(4-Nitro-1H-pyrazol-1-yl)ethanol, 98%, 98% (CAS 42027-81-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C9YA-1g |
| cas | 42027-81-6 |
| size | 1g |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 218.00 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 102.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(4-nitropyrazol-1-yl)ethanol (CAS 42027-81-6) is a chemical compound with the molecular formula C5H7N3O3 and a molecular weight of 157.13 g/mol. IUPAC name: 2-(4-nitropyrazol-1-yl)ethanol. InChIKey: WHPWNPMESFLXQT-UHFFFAOYSA-N.
| Molecular formula | C5H7N3O3 |
|---|---|
| Molecular weight | 157.13 g/mol |
| IUPAC name | 2-(4-nitropyrazol-1-yl)ethanol |
| InChIKey | WHPWNPMESFLXQT-UHFFFAOYSA-N |
| SMILES | C1=C(C=NN1CCO)[N+](=O)[O-] |
Computed by PubChem (NCBI)