cas: 4282-47-7 — see every product listed under this CAS number, including other names
2-(4-Nitrophenyl)pyridine 98% (CAS 4282-47-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A184480-250mg |
| cas | 4282-47-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1010.06 Pln | |
| Ambeed | 1g | 1666.44 Pln | |
| Ambeed | 5g | 3262.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A184480 |
2-(4-nitrophenyl)pyridine (CAS 4282-47-7) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: 2-(4-nitrophenyl)pyridine. InChIKey: FNLTWLXKZQWUJZ-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 2-(4-nitrophenyl)pyridine |
| InChIKey | FNLTWLXKZQWUJZ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)