CAS 216060-23-0 appears in our catalog under these names: 4-(Pyrazin-2-yl)benzoic acid, 95%, 4-(Pyrazin-2-yl)benzoic acid, 98%, 4-(Pyrazin-2-yl)benzoic acid, 4-(Pyrazin-2-yl)benzoic acid 98%, 4-(Pyrazin-2-yl)benzoic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
4-pyrazin-2-ylbenzoic acid (CAS 216060-23-0) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: 4-pyrazin-2-ylbenzoic acid. InChIKey: DCCMRHMNLNXEDE-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 4-pyrazin-2-ylbenzoic acid |
| InChIKey | DCCMRHMNLNXEDE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=CN=C2)C(=O)O |
Computed by PubChem (NCBI)