CAS 268748-84-1 appears in our catalog under these names: 5-Methyl-3-phenyl-4-isoxazolyl isocyanate, 95%, 5-Methyl-3-phenyl-4-isoxazolylisocyanate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 5g, 10g, 250mg, 1g.
4-isocyanato-5-methyl-3-phenyl-1,2-oxazole (CAS 268748-84-1) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: 4-isocyanato-5-methyl-3-phenyl-1,2-oxazole. InChIKey: PQTGYRAJPUYYOM-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 4-isocyanato-5-methyl-3-phenyl-1,2-oxazole |
| InChIKey | PQTGYRAJPUYYOM-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)N=C=O |
Computed by PubChem (NCBI)