cas: 7472-69-7 — see every product listed under this CAS number, including other names
2-(4-bromophenoxy)-2-methylpropanoic acid, 97% (CAS 7472-69-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F307524-1G |
| cas | 7472-69-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1539.06 Pln | |
| Fluorochem | 5g | 4475.53 Pln | |
| Fluorochem | 10g | 6683.08 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-bromophenoxy)-2-methylpropanoic acid (CAS 7472-69-7) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: 2-(4-bromophenoxy)-2-methylpropanoic acid. InChIKey: NRDUHXQTTOHIJX-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO3 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 2-(4-bromophenoxy)-2-methylpropanoic acid |
| InChIKey | NRDUHXQTTOHIJX-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)OC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)